C23H43N3Si — CID 76844178
dimethyl-(1,3,5-triazinan-1-yl)-[3,4,6-tri(propan-2-yl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]silane (PubChem CID 76844178) has the molecular formula C23H43N3Si and a molecular weight of 389.70 g/mol. Its IUPAC name is dimethyl-(1,3,5-triazinan-1-yl)-[3,4,6-tri(propan-2-yl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]silane.
| Compound Name | dimethyl-(1,3,5-triazinan-1-yl)-[3,4,6-tri(propan-2-yl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]silane |
|---|---|
| PubChem CID | 76844178 |
| Molecular Formula | C23H43N3Si |
| Molecular Weight | 389.70 g/mol |
| Exact Mass | 389.32 |
| IUPAC Name | dimethyl-(1,3,5-triazinan-1-yl)-[3,4,6-tri(propan-2-yl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]silane |
| SMILES | CC(C)C1=CC2C(C(C(C)C)=C1)C(C(C)C)CC2[Si](C)(C)N1CNCNC1 |
| InChI | InChI=1S/C23H43N3Si/c1-15(2)18-9-19(16(3)4)23-20(17(5)6)11-22(21(23)10-18)27(7,8)26-13-24-12-25-14-26/h9-10,15-17,20-25H,11-14H2,1-8H3 |
| InChIKey | WKJXRYDKJQHPSA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.70 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|