About 8aH-isoquinolin-1-imine
8aH-isoquinolin-1-imine (PubChem CID 76844481) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 8aH-isoquinolin-1-imine.
Molecular Properties
| Compound Name | 8aH-isoquinolin-1-imine |
| PubChem CID | 76844481 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 8aH-isoquinolin-1-imine |
| SMILES | [H]/N=C1\N=CC=C2C=CC=CC21 |
| InChI | InChI=1S/C9H8N2/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-6,8,10H/b10-9- |
| InChIKey | CRYFKUAIJDTELC-KTKRTIGZSA-N |
| XLogP | 1.72 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 8aH-isoquinolin-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8aH-isoquinolin-1-imine?
The IUPAC name of 8aH-isoquinolin-1-imine (CID 76844481) is 8aH-isoquinolin-1-imine.
What is the SMILES notation for 8aH-isoquinolin-1-imine?
The canonical SMILES for 8aH-isoquinolin-1-imine is [H]/N=C1\N=CC=C2C=CC=CC21.
What is the InChIKey of 8aH-isoquinolin-1-imine?
The InChIKey is CRYFKUAIJDTELC-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H8N2/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-6,8,10H/b10-9-.
What are the key properties of 8aH-isoquinolin-1-imine?
8aH-isoquinolin-1-imine has a molecular weight of 144.18 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8aH-isoquinolin-1-imine is sourced from PubChem (CID 76844481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).