C30H45N3O6 — CID 76844723
[3-[4-[(1E,3E)-4-[4-(diethylamino)phenyl]buta-1,3-dienyl]pyridin-1-ium-1-yl]-2-hydroxypropyl]-(2-hydroxyethyl)-dimethylazanium diacetate (PubChem CID 76844723) has the molecular formula C30H45N3O6 and a molecular weight of 543.71 g/mol. Its IUPAC name is [3-[4-[(1E,3E)-4-[4-(diethylamino)phenyl]buta-1,3-dienyl]pyridin-1-ium-1-yl]-2-hydroxypropyl]-(2-hydroxyethyl)-dimethylazanium diacetate.
| Compound Name | [3-[4-[(1E,3E)-4-[4-(diethylamino)phenyl]buta-1,3-dienyl]pyridin-1-ium-1-yl]-2-hydroxypropyl]-(2-hydroxyethyl)-dimethylazanium diacetate |
|---|---|
| PubChem CID | 76844723 |
| Molecular Formula | C30H45N3O6 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | [3-[4-[(1E,3E)-4-[4-(diethylamino)phenyl]buta-1,3-dienyl]pyridin-1-ium-1-yl]-2-hydroxypropyl]-(2-hydroxyethyl)-dimethylazanium diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].CCN(CC)c1ccc(/C=C/C=C/c2cc[n+](CC(O)C[N+](C)(C)CCO)cc2)cc1 |
| InChI | InChI=1S/C26H39N3O2.2C2H4O2/c1-5-28(6-2)25-13-11-23(12-14-25)9-7-8-10-24-15-17-27(18-16-24)21-26(31)22-29(3,4)19-20-30;2*1-2(3)4/h7-18,26,30-31H,5-6,19-22H2,1-4H3;2*1H3,(H,3,4)/q+2;;/p-2 |
| InChIKey | RTMUHULZOGLCDF-UHFFFAOYSA-L |
| XLogP | 0.49 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|