About 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride
1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride (PubChem CID 76844936) has the molecular formula C6H12ClN3O2
and a molecular weight of 193.63 g/mol. Its IUPAC name is 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride |
| PubChem CID | 76844936 |
| Molecular Formula | C6H12ClN3O2 |
| Molecular Weight | 193.63 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride |
| SMILES | Cl.NCCN1CCC(=O)NC1=O |
| InChI | InChI=1S/C6H11N3O2.ClH/c7-2-4-9-3-1-5(10)8-6(9)11;/h1-4,7H2,(H,8,10,11);1H |
| InChIKey | VRQZMNXCPHRCME-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.63 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride?
The IUPAC name of 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride (CID 76844936) is 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride.
What is the SMILES notation for 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride?
The canonical SMILES for 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride is Cl.NCCN1CCC(=O)NC1=O.
What is the InChIKey of 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride?
The InChIKey is VRQZMNXCPHRCME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2.ClH/c7-2-4-9-3-1-5(10)8-6(9)11;/h1-4,7H2,(H,8,10,11);1H.
What are the key properties of 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride?
1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride has a molecular weight of 193.63 g/mol, XLogP of -0.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoethyl)-1,3-diazinane-2,4-dione;hydrochloride is sourced from PubChem (CID 76844936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).