C14H22N5O2S+ — CID 76844953
(1Z)-1-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-3-ium-5-ylidene)-3-(cyclohexylmethyl)thiourea (PubChem CID 76844953) has the molecular formula C14H22N5O2S+ and a molecular weight of 324.43 g/mol. Its IUPAC name is (1Z)-1-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-3-ium-5-ylidene)-3-(cyclohexylmethyl)thiourea.
| Compound Name | (1Z)-1-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-3-ium-5-ylidene)-3-(cyclohexylmethyl)thiourea |
|---|---|
| PubChem CID | 76844953 |
| Molecular Formula | C14H22N5O2S+ |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (1Z)-1-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-3-ium-5-ylidene)-3-(cyclohexylmethyl)thiourea |
| SMILES | CN1C(=O)/C(=N\C(=S)NCC2CCCCC2)C(N)=[N+](C)C1=O |
| InChI | InChI=1S/C14H21N5O2S/c1-18-11(15)10(12(20)19(2)14(18)21)17-13(22)16-8-9-6-4-3-5-7-9/h9,15H,3-8H2,1-2H3,(H,16,22)/p+1/b17-10- |
| InChIKey | CQSXEBOJPJDQRS-YVLHZVERSA-O |
| XLogP | 0.47 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|