C17H25BN2O3 — CID 76845132
1-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperidin-4-one (PubChem CID 76845132) has the molecular formula C17H25BN2O3 and a molecular weight of 316.21 g/mol. Its IUPAC name is 1-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperidin-4-one.
| Compound Name | 1-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperidin-4-one |
|---|---|
| PubChem CID | 76845132 |
| Molecular Formula | C17H25BN2O3 |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 1-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperidin-4-one |
| SMILES | Cc1cc(N2CCC(=O)CC2)ncc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H25BN2O3/c1-12-10-15(20-8-6-13(21)7-9-20)19-11-14(12)18-22-16(2,3)17(4,5)23-18/h10-11H,6-9H2,1-5H3 |
| InChIKey | BGIDMTUTXXYECV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|