About 2-ethylsulfanyl-1,3-diazinan-4-one
2-ethylsulfanyl-1,3-diazinan-4-one (PubChem CID 76845196) has the molecular formula C6H12N2OS
and a molecular weight of 160.24 g/mol. Its IUPAC name is 2-ethylsulfanyl-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-1,3-diazinan-4-one |
| PubChem CID | 76845196 |
| Molecular Formula | C6H12N2OS |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-ethylsulfanyl-1,3-diazinan-4-one |
| SMILES | CCSC1NCCC(=O)N1 |
| InChI | InChI=1S/C6H12N2OS/c1-2-10-6-7-4-3-5(9)8-6/h6-7H,2-4H2,1H3,(H,8,9) |
| InChIKey | CKRMZEMQECYYCP-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylsulfanyl-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-1,3-diazinan-4-one?
The IUPAC name of 2-ethylsulfanyl-1,3-diazinan-4-one (CID 76845196) is 2-ethylsulfanyl-1,3-diazinan-4-one.
What is the SMILES notation for 2-ethylsulfanyl-1,3-diazinan-4-one?
The canonical SMILES for 2-ethylsulfanyl-1,3-diazinan-4-one is CCSC1NCCC(=O)N1.
What is the InChIKey of 2-ethylsulfanyl-1,3-diazinan-4-one?
The InChIKey is CKRMZEMQECYYCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2OS/c1-2-10-6-7-4-3-5(9)8-6/h6-7H,2-4H2,1H3,(H,8,9).
What are the key properties of 2-ethylsulfanyl-1,3-diazinan-4-one?
2-ethylsulfanyl-1,3-diazinan-4-one has a molecular weight of 160.24 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-1,3-diazinan-4-one is sourced from PubChem (CID 76845196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).