C18H21ClO3 — CID 76845658
7-(3-chloropropoxy)-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 76845658) has the molecular formula C18H21ClO3 and a molecular weight of 320.82 g/mol. Its IUPAC name is 7-(3-chloropropoxy)-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 7-(3-chloropropoxy)-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 76845658 |
| Molecular Formula | C18H21ClO3 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 7-(3-chloropropoxy)-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | O=C1C(c2ccccc2)=COC2CC(OCCCCl)CCC12 |
| InChI | InChI=1S/C18H21ClO3/c19-9-4-10-21-14-7-8-15-17(11-14)22-12-16(18(15)20)13-5-2-1-3-6-13/h1-3,5-6,12,14-15,17H,4,7-11H2 |
| InChIKey | VXFYMACSKVHHHR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|