C19H23ClO3 — CID 76845660
7-(4-chlorobutoxy)-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 76845660) has the molecular formula C19H23ClO3 and a molecular weight of 334.84 g/mol. Its IUPAC name is 7-(4-chlorobutoxy)-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 7-(4-chlorobutoxy)-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 76845660 |
| Molecular Formula | C19H23ClO3 |
| Molecular Weight | 334.84 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 7-(4-chlorobutoxy)-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | O=C1C(c2ccccc2)=COC2CC(OCCCCCl)CCC12 |
| InChI | InChI=1S/C19H23ClO3/c20-10-4-5-11-22-15-8-9-16-18(12-15)23-13-17(19(16)21)14-6-2-1-3-7-14/h1-3,6-7,13,15-16,18H,4-5,8-12H2 |
| InChIKey | IFMJENUILYFTSL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.84 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|