About 6-fluoro-1H-indazol-5-ol
6-fluoro-1H-indazol-5-ol (PubChem CID 76846012) has the molecular formula C7H5FN2O
and a molecular weight of 152.13 g/mol. Its IUPAC name is 6-fluoro-1H-indazol-5-ol.
Molecular Properties
| Compound Name | 6-fluoro-1H-indazol-5-ol |
| PubChem CID | 76846012 |
| Molecular Formula | C7H5FN2O |
| Molecular Weight | 152.13 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 6-fluoro-1H-indazol-5-ol |
| SMILES | Oc1cc2cn[nH]c2cc1F |
| InChI | InChI=1S/C7H5FN2O/c8-5-2-6-4(1-7(5)11)3-9-10-6/h1-3,11H,(H,9,10) |
| InChIKey | XDJJDOKXCSVOFZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.13 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-1H-indazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1H-indazol-5-ol?
The IUPAC name of 6-fluoro-1H-indazol-5-ol (CID 76846012) is 6-fluoro-1H-indazol-5-ol.
What is the SMILES notation for 6-fluoro-1H-indazol-5-ol?
The canonical SMILES for 6-fluoro-1H-indazol-5-ol is Oc1cc2cn[nH]c2cc1F.
What is the InChIKey of 6-fluoro-1H-indazol-5-ol?
The InChIKey is XDJJDOKXCSVOFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN2O/c8-5-2-6-4(1-7(5)11)3-9-10-6/h1-3,11H,(H,9,10).
What are the key properties of 6-fluoro-1H-indazol-5-ol?
6-fluoro-1H-indazol-5-ol has a molecular weight of 152.13 g/mol, XLogP of 1.41, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1H-indazol-5-ol is sourced from PubChem (CID 76846012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).