About 7-ethoxy-4H-1,4-benzothiazin-3-one
7-ethoxy-4H-1,4-benzothiazin-3-one (PubChem CID 768468) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is 7-ethoxy-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 7-ethoxy-4H-1,4-benzothiazin-3-one |
| PubChem CID | 768468 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 7-ethoxy-4H-1,4-benzothiazin-3-one |
| SMILES | CCOc1ccc2c(c1)SCC(=O)N2 |
| InChI | InChI=1S/C10H11NO2S/c1-2-13-7-3-4-8-9(5-7)14-6-10(12)11-8/h3-5H,2,6H2,1H3,(H,11,12) |
| InChIKey | UYUUNYNVHRTORT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-ethoxy-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-4H-1,4-benzothiazin-3-one?
The IUPAC name of 7-ethoxy-4H-1,4-benzothiazin-3-one (CID 768468) is 7-ethoxy-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 7-ethoxy-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 7-ethoxy-4H-1,4-benzothiazin-3-one is CCOc1ccc2c(c1)SCC(=O)N2.
What is the InChIKey of 7-ethoxy-4H-1,4-benzothiazin-3-one?
The InChIKey is UYUUNYNVHRTORT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S/c1-2-13-7-3-4-8-9(5-7)14-6-10(12)11-8/h3-5H,2,6H2,1H3,(H,11,12).
What are the key properties of 7-ethoxy-4H-1,4-benzothiazin-3-one?
7-ethoxy-4H-1,4-benzothiazin-3-one has a molecular weight of 209.27 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 768468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).