About 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde
7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde (PubChem CID 76846984) has the molecular formula C9H6INO2
and a molecular weight of 287.06 g/mol. Its IUPAC name is 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde.
Molecular Properties
| Compound Name | 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde |
| PubChem CID | 76846984 |
| Molecular Formula | C9H6INO2 |
| Molecular Weight | 287.06 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde |
| SMILES | O=Cc1cc(I)c2c(c1)CNC2=O |
| InChI | InChI=1S/C9H6INO2/c10-7-2-5(4-12)1-6-3-11-9(13)8(6)7/h1-2,4H,3H2,(H,11,13) |
| InChIKey | YPELRHZLGVDHJQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.06 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde?
The IUPAC name of 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde (CID 76846984) is 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde.
What is the SMILES notation for 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde?
The canonical SMILES for 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde is O=Cc1cc(I)c2c(c1)CNC2=O.
What is the InChIKey of 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde?
The InChIKey is YPELRHZLGVDHJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6INO2/c10-7-2-5(4-12)1-6-3-11-9(13)8(6)7/h1-2,4H,3H2,(H,11,13).
What are the key properties of 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde?
7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde has a molecular weight of 287.06 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-1-oxo-2,3-dihydroisoindole-5-carbaldehyde is sourced from PubChem (CID 76846984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).