About 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine
4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine (PubChem CID 76847035) has the molecular formula C8H8Cl2N4
and a molecular weight of 231.09 g/mol. Its IUPAC name is 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 76847035 |
| Molecular Formula | C8H8Cl2N4 |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine |
| SMILES | CC(C)c1[nH]nc2nc(Cl)nc(Cl)c12 |
| InChI | InChI=1S/C8H8Cl2N4/c1-3(2)5-4-6(9)11-8(10)12-7(4)14-13-5/h3H,1-2H3,(H,11,12,13,14) |
| InChIKey | HJCVCIYLKUNPOS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine?
The IUPAC name of 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine (CID 76847035) is 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine is CC(C)c1[nH]nc2nc(Cl)nc(Cl)c12.
What is the InChIKey of 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine?
The InChIKey is HJCVCIYLKUNPOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2N4/c1-3(2)5-4-6(9)11-8(10)12-7(4)14-13-5/h3H,1-2H3,(H,11,12,13,14).
What are the key properties of 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine?
4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine has a molecular weight of 231.09 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-3-propan-2-yl-2H-pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 76847035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).