About 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine
4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine (PubChem CID 76847045) has the molecular formula C6H2ClF3N4
and a molecular weight of 222.56 g/mol. Its IUPAC name is 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 76847045 |
| Molecular Formula | C6H2ClF3N4 |
| Molecular Weight | 222.56 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine |
| SMILES | FC(F)(F)c1[nH]nc2ncnc(Cl)c12 |
| InChI | InChI=1S/C6H2ClF3N4/c7-4-2-3(6(8,9)10)13-14-5(2)12-1-11-4/h1H,(H,11,12,13,14) |
| InChIKey | TZDRIBGTCKCOTP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine?
The IUPAC name of 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine (CID 76847045) is 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine is FC(F)(F)c1[nH]nc2ncnc(Cl)c12.
What is the InChIKey of 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine?
The InChIKey is TZDRIBGTCKCOTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2ClF3N4/c7-4-2-3(6(8,9)10)13-14-5(2)12-1-11-4/h1H,(H,11,12,13,14).
What are the key properties of 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine?
4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine has a molecular weight of 222.56 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(trifluoromethyl)-2H-pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 76847045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).