C9H10ClN3 — CID 76847159
4-chloro-3-propan-2-yl-2H-pyrazolo[4,3-c]pyridine (PubChem CID 76847159) has the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. Its IUPAC name is 4-chloro-3-propan-2-yl-2H-pyrazolo[4,3-c]pyridine.
| Compound Name | 4-chloro-3-propan-2-yl-2H-pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 76847159 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 4-chloro-3-propan-2-yl-2H-pyrazolo[4,3-c]pyridine |
| SMILES | CC(C)c1[nH]nc2ccnc(Cl)c12 |
| InChI | InChI=1S/C9H10ClN3/c1-5(2)8-7-6(12-13-8)3-4-11-9(7)10/h3-5H,1-2H3,(H,12,13) |
| InChIKey | YAYNGDQEUOQIHG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|