C12H13F6NO — CID 76847626
2-(2-amino-4-propan-2-ylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 76847626) has the molecular formula C12H13F6NO and a molecular weight of 301.23 g/mol. Its IUPAC name is 2-(2-amino-4-propan-2-ylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(2-amino-4-propan-2-ylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 76847626 |
| Molecular Formula | C12H13F6NO |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(2-amino-4-propan-2-ylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC(C)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)c(N)c1 |
| InChI | InChI=1S/C12H13F6NO/c1-6(2)7-3-4-8(9(19)5-7)10(20,11(13,14)15)12(16,17)18/h3-6,20H,19H2,1-2H3 |
| InChIKey | WGPSMNNDEYFHJR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|