C7H4F2N2O — CID 76847803
4,5-difluoro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (PubChem CID 76847803) has the molecular formula C7H4F2N2O and a molecular weight of 170.12 g/mol. Its IUPAC name is 4,5-difluoro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 4,5-difluoro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 76847803 |
| Molecular Formula | C7H4F2N2O |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 4,5-difluoro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1Cc2c(ncc(F)c2F)N1 |
| InChI | InChI=1S/C7H4F2N2O/c8-4-2-10-7-3(6(4)9)1-5(12)11-7/h2H,1H2,(H,10,11,12) |
| InChIKey | KPQLVUWWNABETR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |