About 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one
4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (PubChem CID 76847812) has the molecular formula C7H4BrClN2O
and a molecular weight of 247.48 g/mol. Its IUPAC name is 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one.
Molecular Properties
| Compound Name | 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| PubChem CID | 76847812 |
| Molecular Formula | C7H4BrClN2O |
| Molecular Weight | 247.48 g/mol |
| Exact Mass | 245.92 |
| IUPAC Name | 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1Cc2c(Br)cc(Cl)nc2N1 |
| InChI | InChI=1S/C7H4BrClN2O/c8-4-2-5(9)10-7-3(4)1-6(12)11-7/h2H,1H2,(H,10,11,12) |
| InChIKey | MGQSWHFVWSBWLY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one?
The IUPAC name of 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CID 76847812) is 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one.
What is the SMILES notation for 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one?
The canonical SMILES for 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one is O=C1Cc2c(Br)cc(Cl)nc2N1.
What is the InChIKey of 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one?
The InChIKey is MGQSWHFVWSBWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrClN2O/c8-4-2-5(9)10-7-3(4)1-6(12)11-7/h2H,1H2,(H,10,11,12).
What are the key properties of 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one?
4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one has a molecular weight of 247.48 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one is sourced from PubChem (CID 76847812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).