About 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one
4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (PubChem CID 76847816) has the molecular formula C8H7FN2O2
and a molecular weight of 182.15 g/mol. Its IUPAC name is 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one.
Molecular Properties
| Compound Name | 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| PubChem CID | 76847816 |
| Molecular Formula | C8H7FN2O2 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| SMILES | COc1cnc2c(c1F)CC(=O)N2 |
| InChI | InChI=1S/C8H7FN2O2/c1-13-5-3-10-8-4(7(5)9)2-6(12)11-8/h3H,2H2,1H3,(H,10,11,12) |
| InChIKey | OPJFDBAXMCWREU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one?
The IUPAC name of 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CID 76847816) is 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one.
What is the SMILES notation for 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one?
The canonical SMILES for 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one is COc1cnc2c(c1F)CC(=O)N2.
What is the InChIKey of 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one?
The InChIKey is OPJFDBAXMCWREU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN2O2/c1-13-5-3-10-8-4(7(5)9)2-6(12)11-8/h3H,2H2,1H3,(H,10,11,12).
What are the key properties of 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one?
4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one has a molecular weight of 182.15 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-5-methoxy-1,3-dihydropyrrolo[2,3-b]pyridin-2-one is sourced from PubChem (CID 76847816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).