C13H18N4O3 — CID 76847904
3-(2-methoxy-4-pyridinyl)-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole (PubChem CID 76847904) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-(2-methoxy-4-pyridinyl)-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole.
| Compound Name | 3-(2-methoxy-4-pyridinyl)-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole |
|---|---|
| PubChem CID | 76847904 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 3-(2-methoxy-4-pyridinyl)-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole |
| SMILES | COc1cc(C2NNC3CCC([N+](=O)[O-])CC32)ccn1 |
| InChI | InChI=1S/C13H18N4O3/c1-20-12-6-8(4-5-14-12)13-10-7-9(17(18)19)2-3-11(10)15-16-13/h4-6,9-11,13,15-16H,2-3,7H2,1H3 |
| InChIKey | RRTKIHGJEJBAGV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|