About 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one
3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 76848612) has the molecular formula C7H5ClN2O
and a molecular weight of 168.58 g/mol. Its IUPAC name is 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| PubChem CID | 76848612 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NCc2ncc(Cl)cc21 |
| InChI | InChI=1S/C7H5ClN2O/c8-4-1-5-6(9-2-4)3-10-7(5)11/h1-2H,3H2,(H,10,11) |
| InChIKey | DEIJFACUGWLVHU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The IUPAC name of 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (CID 76848612) is 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
What is the SMILES notation for 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The canonical SMILES for 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one is O=C1NCc2ncc(Cl)cc21.
What is the InChIKey of 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The InChIKey is DEIJFACUGWLVHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O/c8-4-1-5-6(9-2-4)3-10-7(5)11/h1-2H,3H2,(H,10,11).
What are the key properties of 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one has a molecular weight of 168.58 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one is sourced from PubChem (CID 76848612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).