About 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine
2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine (PubChem CID 76849265) has the molecular formula C11H15N3S
and a molecular weight of 221.33 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine |
| PubChem CID | 76849265 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine |
| SMILES | CN(C)CCSc1cccc2nccn12 |
| InChI | InChI=1S/C11H15N3S/c1-13(2)8-9-15-11-5-3-4-10-12-6-7-14(10)11/h3-7H,8-9H2,1-2H3 |
| InChIKey | CAQODCQFONTAJF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine?
The IUPAC name of 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine (CID 76849265) is 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine.
What is the SMILES notation for 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine?
The canonical SMILES for 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine is CN(C)CCSc1cccc2nccn12.
What is the InChIKey of 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine?
The InChIKey is CAQODCQFONTAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3S/c1-13(2)8-9-15-11-5-3-4-10-12-6-7-14(10)11/h3-7H,8-9H2,1-2H3.
What are the key properties of 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine?
2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine has a molecular weight of 221.33 g/mol, XLogP of 1.99, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-N,N-dimethylethanamine is sourced from PubChem (CID 76849265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).