About 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone
1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone (PubChem CID 76849284) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone |
| PubChem CID | 76849284 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone |
| SMILES | CC(=O)c1n[nH]c2cccnc12 |
| InChI | InChI=1S/C8H7N3O/c1-5(12)7-8-6(10-11-7)3-2-4-9-8/h2-4H,1H3,(H,10,11) |
| InChIKey | KFGXMRHEDKZLTD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone?
The IUPAC name of 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone (CID 76849284) is 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone.
What is the SMILES notation for 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone?
The canonical SMILES for 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone is CC(=O)c1n[nH]c2cccnc12.
What is the InChIKey of 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone?
The InChIKey is KFGXMRHEDKZLTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c1-5(12)7-8-6(10-11-7)3-2-4-9-8/h2-4H,1H3,(H,10,11).
What are the key properties of 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone?
1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone has a molecular weight of 161.16 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-pyrazolo[4,3-b]pyridin-3-yl)ethanone is sourced from PubChem (CID 76849284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).