C8H9F3N4O — CID 76849414
N-[3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-1-yl]formamide (PubChem CID 76849414) has the molecular formula C8H9F3N4O and a molecular weight of 234.18 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-1-yl]formamide.
| Compound Name | N-[3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-1-yl]formamide |
|---|---|
| PubChem CID | 76849414 |
| Molecular Formula | C8H9F3N4O |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | N-[3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-1-yl]formamide |
| SMILES | O=CNc1nc(C(F)(F)F)n2c1CNCC2 |
| InChI | InChI=1S/C8H9F3N4O/c9-8(10,11)7-14-6(13-4-16)5-3-12-1-2-15(5)7/h4,12H,1-3H2,(H,13,16) |
| InChIKey | CLYWWAQECOVBIJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|