About 7-oxidoimidazo[1,5-a]pyrazin-7-ium
7-oxidoimidazo[1,5-a]pyrazin-7-ium (PubChem CID 76849753) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is 7-oxidoimidazo[1,5-a]pyrazin-7-ium.
Molecular Properties
| Compound Name | 7-oxidoimidazo[1,5-a]pyrazin-7-ium |
| PubChem CID | 76849753 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 7-oxidoimidazo[1,5-a]pyrazin-7-ium |
| SMILES | [O-][n+]1ccn2cncc2c1 |
| InChI | InChI=1S/C6H5N3O/c10-9-2-1-8-5-7-3-6(8)4-9/h1-5H |
| InChIKey | PXFUMRQYBRZLNO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-oxidoimidazo[1,5-a]pyrazin-7-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxidoimidazo[1,5-a]pyrazin-7-ium?
The IUPAC name of 7-oxidoimidazo[1,5-a]pyrazin-7-ium (CID 76849753) is 7-oxidoimidazo[1,5-a]pyrazin-7-ium.
What is the SMILES notation for 7-oxidoimidazo[1,5-a]pyrazin-7-ium?
The canonical SMILES for 7-oxidoimidazo[1,5-a]pyrazin-7-ium is [O-][n+]1ccn2cncc2c1.
What is the InChIKey of 7-oxidoimidazo[1,5-a]pyrazin-7-ium?
The InChIKey is PXFUMRQYBRZLNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O/c10-9-2-1-8-5-7-3-6(8)4-9/h1-5H.
What are the key properties of 7-oxidoimidazo[1,5-a]pyrazin-7-ium?
7-oxidoimidazo[1,5-a]pyrazin-7-ium has a molecular weight of 135.13 g/mol, XLogP of -0.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxidoimidazo[1,5-a]pyrazin-7-ium is sourced from PubChem (CID 76849753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).