About 8-chloro-6-phenylimidazo[1,5-a]pyrazine
8-chloro-6-phenylimidazo[1,5-a]pyrazine (PubChem CID 76849768) has the molecular formula C12H8ClN3
and a molecular weight of 229.67 g/mol. Its IUPAC name is 8-chloro-6-phenylimidazo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 8-chloro-6-phenylimidazo[1,5-a]pyrazine |
| PubChem CID | 76849768 |
| Molecular Formula | C12H8ClN3 |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 8-chloro-6-phenylimidazo[1,5-a]pyrazine |
| SMILES | Clc1nc(-c2ccccc2)cn2cncc12 |
| InChI | InChI=1S/C12H8ClN3/c13-12-11-6-14-8-16(11)7-10(15-12)9-4-2-1-3-5-9/h1-8H |
| InChIKey | HMYPWYNSEMBWHL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-6-phenylimidazo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-6-phenylimidazo[1,5-a]pyrazine?
The IUPAC name of 8-chloro-6-phenylimidazo[1,5-a]pyrazine (CID 76849768) is 8-chloro-6-phenylimidazo[1,5-a]pyrazine.
What is the SMILES notation for 8-chloro-6-phenylimidazo[1,5-a]pyrazine?
The canonical SMILES for 8-chloro-6-phenylimidazo[1,5-a]pyrazine is Clc1nc(-c2ccccc2)cn2cncc12.
What is the InChIKey of 8-chloro-6-phenylimidazo[1,5-a]pyrazine?
The InChIKey is HMYPWYNSEMBWHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClN3/c13-12-11-6-14-8-16(11)7-10(15-12)9-4-2-1-3-5-9/h1-8H.
What are the key properties of 8-chloro-6-phenylimidazo[1,5-a]pyrazine?
8-chloro-6-phenylimidazo[1,5-a]pyrazine has a molecular weight of 229.67 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-6-phenylimidazo[1,5-a]pyrazine is sourced from PubChem (CID 76849768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).