About 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde
6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde (PubChem CID 76849862) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde |
| PubChem CID | 76849862 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde |
| SMILES | Cc1ncc2ncc(C=O)cn12 |
| InChI | InChI=1S/C8H7N3O/c1-6-9-3-8-10-2-7(5-12)4-11(6)8/h2-5H,1H3 |
| InChIKey | MYFFBKYDPMYJJN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde?
The IUPAC name of 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde (CID 76849862) is 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde.
What is the SMILES notation for 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde?
The canonical SMILES for 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde is Cc1ncc2ncc(C=O)cn12.
What is the InChIKey of 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde?
The InChIKey is MYFFBKYDPMYJJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c1-6-9-3-8-10-2-7(5-12)4-11(6)8/h2-5H,1H3.
What are the key properties of 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde?
6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde has a molecular weight of 161.16 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylimidazo[1,5-a]pyrimidine-3-carbaldehyde is sourced from PubChem (CID 76849862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).