C16H27BN2O3 — CID 76850015
N-(3-methoxypropyl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 76850015) has the molecular formula C16H27BN2O3 and a molecular weight of 306.22 g/mol. Its IUPAC name is N-(3-methoxypropyl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | N-(3-methoxypropyl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 76850015 |
| Molecular Formula | C16H27BN2O3 |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-(3-methoxypropyl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | COCCCNc1ncc(B2OC(C)(C)C(C)(C)O2)cc1C |
| InChI | InChI=1S/C16H27BN2O3/c1-12-10-13(11-19-14(12)18-8-7-9-20-6)17-21-15(2,3)16(4,5)22-17/h10-11H,7-9H2,1-6H3,(H,18,19) |
| InChIKey | GFMQUSOAPSKZHB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|