C9H18N2O3 — CID 76850218
tert-butyl N-[(3S,4R)-4-aminooxolan-3-yl]carbamate (PubChem CID 76850218) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-4-aminooxolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R)-4-aminooxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 76850218 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | tert-butyl N-[(3S,4R)-4-aminooxolan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1COC[C@@H]1N |
| InChI | InChI=1S/C9H18N2O3/c1-9(2,3)14-8(12)11-7-5-13-4-6(7)10/h6-7H,4-5,10H2,1-3H3,(H,11,12)/t6-,7+/m0/s1 |
| InChIKey | HWYDCYLRWDJCCH-NKWVEPMBSA-N |
| XLogP | 0.24 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |