C14H12N4OS — CID 76850221
5,7-dimethyl-6-phenyldiazenyl-3H-[1,3]thiazolo[4,5-b]pyridin-2-one (PubChem CID 76850221) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is 5,7-dimethyl-6-phenyldiazenyl-3H-[1,3]thiazolo[4,5-b]pyridin-2-one.
| Compound Name | 5,7-dimethyl-6-phenyldiazenyl-3H-[1,3]thiazolo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 76850221 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 5,7-dimethyl-6-phenyldiazenyl-3H-[1,3]thiazolo[4,5-b]pyridin-2-one |
| SMILES | Cc1nc2[nH]c(=O)sc2c(C)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C14H12N4OS/c1-8-11(18-17-10-6-4-3-5-7-10)9(2)15-13-12(8)20-14(19)16-13/h3-7H,1-2H3,(H,15,16,19)/b18-17+ |
| InChIKey | DXCKYQTYXQECHF-ISLYRVAYSA-N |
| XLogP | 4.02 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|