About [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde
[1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde (PubChem CID 76850412) has the molecular formula C7H4N2OS
and a molecular weight of 164.19 g/mol. Its IUPAC name is [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde.
Molecular Properties
| Compound Name | [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde |
| PubChem CID | 76850412 |
| Molecular Formula | C7H4N2OS |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.00 |
| IUPAC Name | [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde |
| SMILES | O=Cc1cnc2ncsc2c1 |
| InChI | InChI=1S/C7H4N2OS/c10-3-5-1-6-7(8-2-5)9-4-11-6/h1-4H |
| InChIKey | KJJKFIUCVSLVNX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde?
The IUPAC name of [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde (CID 76850412) is [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde.
What is the SMILES notation for [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde?
The canonical SMILES for [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde is O=Cc1cnc2ncsc2c1.
What is the InChIKey of [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde?
The InChIKey is KJJKFIUCVSLVNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2OS/c10-3-5-1-6-7(8-2-5)9-4-11-6/h1-4H.
What are the key properties of [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde?
[1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde has a molecular weight of 164.19 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]thiazolo[4,5-b]pyridine-6-carbaldehyde is sourced from PubChem (CID 76850412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).