About 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile
2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile (PubChem CID 76850416) has the molecular formula C7H2ClN3S
and a molecular weight of 195.63 g/mol. Its IUPAC name is 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile.
Molecular Properties
| Compound Name | 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile |
| PubChem CID | 76850416 |
| Molecular Formula | C7H2ClN3S |
| Molecular Weight | 195.63 g/mol |
| Exact Mass | 194.97 |
| IUPAC Name | 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile |
| SMILES | N#Cc1cnc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C7H2ClN3S/c8-7-11-6-5(12-7)1-4(2-9)3-10-6/h1,3H |
| InChIKey | RSUWGNPQLDZYJO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.63 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
The IUPAC name of 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile (CID 76850416) is 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile.
What is the SMILES notation for 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
The canonical SMILES for 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile is N#Cc1cnc2nc(Cl)sc2c1.
What is the InChIKey of 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
The InChIKey is RSUWGNPQLDZYJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2ClN3S/c8-7-11-6-5(12-7)1-4(2-9)3-10-6/h1,3H.
What are the key properties of 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile has a molecular weight of 195.63 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile is sourced from PubChem (CID 76850416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).