About methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate
methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate (PubChem CID 76850514) has the molecular formula C11H12N2O2S
and a molecular weight of 236.30 g/mol. Its IUPAC name is methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate |
| PubChem CID | 76850514 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate |
| SMILES | CCc1nc2c(C(=O)OC)nc(C)cc2s1 |
| InChI | InChI=1S/C11H12N2O2S/c1-4-8-13-9-7(16-8)5-6(2)12-10(9)11(14)15-3/h5H,4H2,1-3H3 |
| InChIKey | HKFOZCJFBCTMJJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate?
The IUPAC name of methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate (CID 76850514) is methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate.
What is the SMILES notation for methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate?
The canonical SMILES for methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate is CCc1nc2c(C(=O)OC)nc(C)cc2s1.
What is the InChIKey of methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate?
The InChIKey is HKFOZCJFBCTMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S/c1-4-8-13-9-7(16-8)5-6(2)12-10(9)11(14)15-3/h5H,4H2,1-3H3.
What are the key properties of methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate?
methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate has a molecular weight of 236.30 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-6-methyl-[1,3]thiazolo[4,5-c]pyridine-4-carboxylate is sourced from PubChem (CID 76850514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).