C13H19NO — CID 76850618
(2R,4S)-4-ethoxy-2,6-dimethyl-1,2,3,4-tetrahydroquinoline (PubChem CID 76850618) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (2R,4S)-4-ethoxy-2,6-dimethyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R,4S)-4-ethoxy-2,6-dimethyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 76850618 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (2R,4S)-4-ethoxy-2,6-dimethyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCO[C@H]1C[C@@H](C)Nc2ccc(C)cc21 |
| InChI | InChI=1S/C13H19NO/c1-4-15-13-8-10(3)14-12-6-5-9(2)7-11(12)13/h5-7,10,13-14H,4,8H2,1-3H3/t10-,13+/m1/s1 |
| InChIKey | HGKYVZNOMXOEKP-MFKMUULPSA-N |
| XLogP | 3.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |