About 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole
5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole (PubChem CID 76850753) has the molecular formula C12H14ClN3
and a molecular weight of 235.72 g/mol. Its IUPAC name is 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole.
Molecular Properties
| Compound Name | 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole |
| PubChem CID | 76850753 |
| Molecular Formula | C12H14ClN3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole |
| SMILES | Clc1ccc2c(c1)CCN2CC1=NCCN1 |
| InChI | InChI=1S/C12H14ClN3/c13-10-1-2-11-9(7-10)3-6-16(11)8-12-14-4-5-15-12/h1-2,7H,3-6,8H2,(H,14,15) |
| InChIKey | MTFKDWZFIRAIGD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole?
The IUPAC name of 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole (CID 76850753) is 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole.
What is the SMILES notation for 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole?
The canonical SMILES for 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole is Clc1ccc2c(c1)CCN2CC1=NCCN1.
What is the InChIKey of 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole?
The InChIKey is MTFKDWZFIRAIGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3/c13-10-1-2-11-9(7-10)3-6-16(11)8-12-14-4-5-15-12/h1-2,7H,3-6,8H2,(H,14,15).
What are the key properties of 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole?
5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole has a molecular weight of 235.72 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,3-dihydroindole is sourced from PubChem (CID 76850753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).