About 7-chloro-3,4-dihydro-2H-chromen-4-ol
7-chloro-3,4-dihydro-2H-chromen-4-ol (PubChem CID 76851067) has the molecular formula C9H9ClO2
and a molecular weight of 184.62 g/mol. Its IUPAC name is 7-chloro-3,4-dihydro-2H-chromen-4-ol.
Molecular Properties
| Compound Name | 7-chloro-3,4-dihydro-2H-chromen-4-ol |
| PubChem CID | 76851067 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 7-chloro-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OC1CCOc2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H9ClO2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-2,5,8,11H,3-4H2 |
| InChIKey | CTDYKWYKIBZVPN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-3,4-dihydro-2H-chromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3,4-dihydro-2H-chromen-4-ol?
The IUPAC name of 7-chloro-3,4-dihydro-2H-chromen-4-ol (CID 76851067) is 7-chloro-3,4-dihydro-2H-chromen-4-ol.
What is the SMILES notation for 7-chloro-3,4-dihydro-2H-chromen-4-ol?
The canonical SMILES for 7-chloro-3,4-dihydro-2H-chromen-4-ol is OC1CCOc2cc(Cl)ccc21.
What is the InChIKey of 7-chloro-3,4-dihydro-2H-chromen-4-ol?
The InChIKey is CTDYKWYKIBZVPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-2,5,8,11H,3-4H2.
What are the key properties of 7-chloro-3,4-dihydro-2H-chromen-4-ol?
7-chloro-3,4-dihydro-2H-chromen-4-ol has a molecular weight of 184.62 g/mol, XLogP of 2.16, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3,4-dihydro-2H-chromen-4-ol is sourced from PubChem (CID 76851067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).