About (2-amino-4-fluorophenyl) nitrite
(2-amino-4-fluorophenyl) nitrite (PubChem CID 76851388) has the molecular formula C6H5FN2O2
and a molecular weight of 156.12 g/mol. Its IUPAC name is (2-amino-4-fluorophenyl) nitrite.
Molecular Properties
| Compound Name | (2-amino-4-fluorophenyl) nitrite |
| PubChem CID | 76851388 |
| Molecular Formula | C6H5FN2O2 |
| Molecular Weight | 156.12 g/mol |
| Exact Mass | 156.03 |
| IUPAC Name | (2-amino-4-fluorophenyl) nitrite |
| SMILES | Nc1cc(F)ccc1ON=O |
| InChI | InChI=1S/C6H5FN2O2/c7-4-1-2-6(11-9-10)5(8)3-4/h1-3H,8H2 |
| InChIKey | VRJKGJFRGPBKBL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.12 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-4-fluorophenyl) nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4-fluorophenyl) nitrite?
The IUPAC name of (2-amino-4-fluorophenyl) nitrite (CID 76851388) is (2-amino-4-fluorophenyl) nitrite.
What is the SMILES notation for (2-amino-4-fluorophenyl) nitrite?
The canonical SMILES for (2-amino-4-fluorophenyl) nitrite is Nc1cc(F)ccc1ON=O.
What is the InChIKey of (2-amino-4-fluorophenyl) nitrite?
The InChIKey is VRJKGJFRGPBKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FN2O2/c7-4-1-2-6(11-9-10)5(8)3-4/h1-3H,8H2.
What are the key properties of (2-amino-4-fluorophenyl) nitrite?
(2-amino-4-fluorophenyl) nitrite has a molecular weight of 156.12 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4-fluorophenyl) nitrite is sourced from PubChem (CID 76851388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).