C21H19NO5 — CID 7685139
7-[[(5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy]-4-methylchromen-2-one (PubChem CID 7685139) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is 7-[[(5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy]-4-methylchromen-2-one.
| Compound Name | 7-[[(5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 7685139 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 7-[[(5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy]-4-methylchromen-2-one |
| SMILES | COc1ccccc1C1=NO[C@H](COc2ccc3c(C)cc(=O)oc3c2)C1 |
| InChI | InChI=1S/C21H19NO5/c1-13-9-21(23)26-20-11-14(7-8-16(13)20)25-12-15-10-18(22-27-15)17-5-3-4-6-19(17)24-2/h3-9,11,15H,10,12H2,1-2H3/t15-/m0/s1 |
| InChIKey | IUBNADXYLDCCDW-HNNXBMFYSA-N |
| XLogP | 3.68 |
| TPSA | 70.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|