C11H15N3O2 — CID 76851527
3-methyl-6-prop-2-enyl-4a,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 76851527) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-methyl-6-prop-2-enyl-4a,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-methyl-6-prop-2-enyl-4a,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 76851527 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-methyl-6-prop-2-enyl-4a,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | C=CCN1CCC2=NC(=O)N(C)C(=O)C2C1 |
| InChI | InChI=1S/C11H15N3O2/c1-3-5-14-6-4-9-8(7-14)10(15)13(2)11(16)12-9/h3,8H,1,4-7H2,2H3 |
| InChIKey | SPMRWJFUZBPBKT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|