About 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde
4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde (PubChem CID 76851670) has the molecular formula C16H10N2O4
and a molecular weight of 294.27 g/mol. Its IUPAC name is 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde |
| PubChem CID | 76851670 |
| Molecular Formula | C16H10N2O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2ncc(-c3ccc([N+](=O)[O-])cc3)o2)cc1 |
| InChI | InChI=1S/C16H10N2O4/c19-10-11-1-3-13(4-2-11)16-17-9-15(22-16)12-5-7-14(8-6-12)18(20)21/h1-10H |
| InChIKey | BSQBIZYWFHNPNK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde?
The IUPAC name of 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde (CID 76851670) is 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde.
What is the SMILES notation for 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde?
The canonical SMILES for 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde is O=Cc1ccc(-c2ncc(-c3ccc([N+](=O)[O-])cc3)o2)cc1.
What is the InChIKey of 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde?
The InChIKey is BSQBIZYWFHNPNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O4/c19-10-11-1-3-13(4-2-11)16-17-9-15(22-16)12-5-7-14(8-6-12)18(20)21/h1-10H.
What are the key properties of 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde?
4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde has a molecular weight of 294.27 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]benzaldehyde is sourced from PubChem (CID 76851670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).