C12H6ClF5N2O — CID 76851699
4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline (PubChem CID 76851699) has the molecular formula C12H6ClF5N2O and a molecular weight of 324.64 g/mol. Its IUPAC name is 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline.
| Compound Name | 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline |
|---|---|
| PubChem CID | 76851699 |
| Molecular Formula | C12H6ClF5N2O |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline |
| SMILES | Nc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)c(F)c1F |
| InChI | InChI=1S/C12H6ClF5N2O/c13-6-3-5(12(16,17)18)4-20-11(6)21-8-2-1-7(19)9(14)10(8)15/h1-4H,19H2 |
| InChIKey | KQDNCLHJTUMVCF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|