About 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline
4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline (PubChem CID 76851699) has the molecular formula C12H6ClF5N2O
and a molecular weight of 324.64 g/mol. Its IUPAC name is 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline.
Molecular Properties
| Compound Name | 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline |
| PubChem CID | 76851699 |
| Molecular Formula | C12H6ClF5N2O |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline |
| SMILES | Nc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)c(F)c1F |
| InChI | InChI=1S/C12H6ClF5N2O/c13-6-3-5(12(16,17)18)4-20-11(6)21-8-2-1-7(19)9(14)10(8)15/h1-4H,19H2 |
| InChIKey | KQDNCLHJTUMVCF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline?
The IUPAC name of 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline (CID 76851699) is 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline.
What is the SMILES notation for 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline?
The canonical SMILES for 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline is Nc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)c(F)c1F.
What is the InChIKey of 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline?
The InChIKey is KQDNCLHJTUMVCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6ClF5N2O/c13-6-3-5(12(16,17)18)4-20-11(6)21-8-2-1-7(19)9(14)10(8)15/h1-4H,19H2.
What are the key properties of 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline?
4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline has a molecular weight of 324.64 g/mol, XLogP of 4.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3-difluoroaniline is sourced from PubChem (CID 76851699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).