About (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate
(2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate (PubChem CID 76851845) has the molecular formula C11H13NO6
and a molecular weight of 255.23 g/mol. Its IUPAC name is (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate |
| PubChem CID | 76851845 |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate |
| SMILES | CCc1cnc(OC(=O)O)c(OC(=O)O)c1CC |
| InChI | InChI=1S/C11H13NO6/c1-3-6-5-12-9(18-11(15)16)8(7(6)4-2)17-10(13)14/h5H,3-4H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | MIKXXSLHYJJIEX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate?
The IUPAC name of (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate (CID 76851845) is (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate.
What is the SMILES notation for (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate?
The canonical SMILES for (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate is CCc1cnc(OC(=O)O)c(OC(=O)O)c1CC.
What is the InChIKey of (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate?
The InChIKey is MIKXXSLHYJJIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO6/c1-3-6-5-12-9(18-11(15)16)8(7(6)4-2)17-10(13)14/h5H,3-4H2,1-2H3,(H,13,14)(H,15,16).
What are the key properties of (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate?
(2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate has a molecular weight of 255.23 g/mol, XLogP of 2.32, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carboxyoxy-4,5-diethyl-3-pyridinyl) hydrogen carbonate is sourced from PubChem (CID 76851845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).