C9H6N4OS2 — CID 76851960
N-[3,5-bis(sulfanylidene)-1,2,4-triazol-4-yl]benzamide (PubChem CID 76851960) has the molecular formula C9H6N4OS2 and a molecular weight of 250.31 g/mol. Its IUPAC name is N-[3,5-bis(sulfanylidene)-1,2,4-triazol-4-yl]benzamide.
| Compound Name | N-[3,5-bis(sulfanylidene)-1,2,4-triazol-4-yl]benzamide |
|---|---|
| PubChem CID | 76851960 |
| Molecular Formula | C9H6N4OS2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | N-[3,5-bis(sulfanylidene)-1,2,4-triazol-4-yl]benzamide |
| SMILES | O=C(NN1C(=S)N=NC1=S)c1ccccc1 |
| InChI | InChI=1S/C9H6N4OS2/c14-7(6-4-2-1-3-5-6)12-13-8(15)10-11-9(13)16/h1-5H,(H,12,14) |
| InChIKey | WIWGJGRDCBDYGR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|