About N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide
N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide (PubChem CID 76852170) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide.
Molecular Properties
| Compound Name | N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide |
| PubChem CID | 76852170 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide |
| SMILES | CC/N=C(\CC)N(CC)C(=O)CC |
| InChI | InChI=1S/C10H20N2O/c1-5-9(11-7-3)12(8-4)10(13)6-2/h5-8H2,1-4H3/b11-9+ |
| InChIKey | JJHGKAIDMZNCDT-PKNBQFBNSA-N |
| XLogP | 2.07 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide?
The IUPAC name of N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide (CID 76852170) is N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide.
What is the SMILES notation for N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide?
The canonical SMILES for N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide is CC/N=C(\CC)N(CC)C(=O)CC.
What is the InChIKey of N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide?
The InChIKey is JJHGKAIDMZNCDT-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H20N2O/c1-5-9(11-7-3)12(8-4)10(13)6-2/h5-8H2,1-4H3/b11-9+.
What are the key properties of N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide?
N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide has a molecular weight of 184.28 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(C,N-diethylcarbonimidoyl)-N-ethylpropanamide is sourced from PubChem (CID 76852170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).