C22H32F3N3O4Si — CID 76852912
ethyl 5-[3-(2,2,2-trifluoroethoxy)pyrrolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylate (PubChem CID 76852912) has the molecular formula C22H32F3N3O4Si and a molecular weight of 487.60 g/mol. Its IUPAC name is ethyl 5-[3-(2,2,2-trifluoroethoxy)pyrrolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylate.
| Compound Name | ethyl 5-[3-(2,2,2-trifluoroethoxy)pyrrolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylate |
|---|---|
| PubChem CID | 76852912 |
| Molecular Formula | C22H32F3N3O4Si |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | ethyl 5-[3-(2,2,2-trifluoroethoxy)pyrrolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(COCC[Si](C)(C)C)c2ccc(N3CCC(OCC(F)(F)F)C3)cc12 |
| InChI | InChI=1S/C22H32F3N3O4Si/c1-5-31-21(29)20-18-12-16(27-9-8-17(13-27)32-14-22(23,24)25)6-7-19(18)28(26-20)15-30-10-11-33(2,3)4/h6-7,12,17H,5,8-11,13-15H2,1-4H3 |
| InChIKey | OOMQPPDUUADMCV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|