About (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine
(9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine (PubChem CID 76853169) has the molecular formula C17H15N3O
and a molecular weight of 277.33 g/mol. Its IUPAC name is (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine.
Molecular Properties
| Compound Name | (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine |
| PubChem CID | 76853169 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine |
| SMILES | COc1ccc2c(c1)[nH]c1c3ccncc3cc(CN)c21 |
| InChI | InChI=1S/C17H15N3O/c1-21-12-2-3-14-15(7-12)20-17-13-4-5-19-9-11(13)6-10(8-18)16(14)17/h2-7,9,20H,8,18H2,1H3 |
| InChIKey | JIPWXCWXQYQCQS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine?
The IUPAC name of (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine (CID 76853169) is (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine.
What is the SMILES notation for (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine?
The canonical SMILES for (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine is COc1ccc2c(c1)[nH]c1c3ccncc3cc(CN)c21.
What is the InChIKey of (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine?
The InChIKey is JIPWXCWXQYQCQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O/c1-21-12-2-3-14-15(7-12)20-17-13-4-5-19-9-11(13)6-10(8-18)16(14)17/h2-7,9,20H,8,18H2,1H3.
What are the key properties of (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine?
(9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine has a molecular weight of 277.33 g/mol, XLogP of 3.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9-methoxy-11H-pyrido[4,3-a]carbazol-6-yl)methanamine is sourced from PubChem (CID 76853169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).