C20H26N4O2S — CID 7685328
N-[2-(2-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N',N'-dipropyloxamide (PubChem CID 7685328) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[2-(2-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N',N'-dipropyloxamide.
| Compound Name | N-[2-(2-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N',N'-dipropyloxamide |
|---|---|
| PubChem CID | 7685328 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[2-(2-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N',N'-dipropyloxamide |
| SMILES | CCCN(CCC)C(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2 |
| InChI | InChI=1S/C20H26N4O2S/c1-4-10-23(11-5-2)20(26)19(25)21-18-15-12-27-13-16(15)22-24(18)17-9-7-6-8-14(17)3/h6-9H,4-5,10-13H2,1-3H3,(H,21,25) |
| InChIKey | BLFMSIVASGGIIR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|