C23H29BrO3 — CID 76853394
(2E,6E)-10-(5-bromo-2,4-dimethoxyphenyl)-4,4,7-trimethyl-11-methylidenecycloundeca-2,6-dien-1-one (PubChem CID 76853394) has the molecular formula C23H29BrO3 and a molecular weight of 433.39 g/mol. Its IUPAC name is (2E,6E)-10-(5-bromo-2,4-dimethoxyphenyl)-4,4,7-trimethyl-11-methylidenecycloundeca-2,6-dien-1-one.
| Compound Name | (2E,6E)-10-(5-bromo-2,4-dimethoxyphenyl)-4,4,7-trimethyl-11-methylidenecycloundeca-2,6-dien-1-one |
|---|---|
| PubChem CID | 76853394 |
| Molecular Formula | C23H29BrO3 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (2E,6E)-10-(5-bromo-2,4-dimethoxyphenyl)-4,4,7-trimethyl-11-methylidenecycloundeca-2,6-dien-1-one |
| SMILES | C=C1C(=O)/C=C/C(C)(C)C/C=C(\C)CCC1c1cc(Br)c(OC)cc1OC |
| InChI | InChI=1S/C23H29BrO3/c1-15-7-8-17(16(2)20(25)10-12-23(3,4)11-9-15)18-13-19(24)22(27-6)14-21(18)26-5/h9-10,12-14,17H,2,7-8,11H2,1,3-6H3/b12-10+,15-9+ |
| InChIKey | HUBQOZNUBIEZBJ-WHMVALBYSA-N |
| XLogP | 6.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|