C20H15N9 — CID 76855329
2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2-phenyltriazol-4-yl)prop-2-enenitrile (PubChem CID 76855329) has the molecular formula C20H15N9 and a molecular weight of 381.40 g/mol. Its IUPAC name is 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2-phenyltriazol-4-yl)prop-2-enenitrile.
| Compound Name | 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2-phenyltriazol-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 76855329 |
| Molecular Formula | C20H15N9 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2-phenyltriazol-4-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cnn(-c2ccccc2)n1)c1nc(N)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C20H15N9/c21-12-14(11-16-13-23-29(28-16)17-9-5-2-6-10-17)18-25-19(22)27-20(26-18)24-15-7-3-1-4-8-15/h1-11,13H,(H3,22,24,25,26,27) |
| InChIKey | LTYCWNHFPUSVFC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|