C21H17BrFN3O2S — CID 76859193
3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(3-bromo-4-methylphenyl)prop-2-enamide (PubChem CID 76859193) has the molecular formula C21H17BrFN3O2S and a molecular weight of 474.36 g/mol. Its IUPAC name is 3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(3-bromo-4-methylphenyl)prop-2-enamide.
| Compound Name | 3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(3-bromo-4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 76859193 |
| Molecular Formula | C21H17BrFN3O2S |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(3-bromo-4-methylphenyl)prop-2-enamide |
| SMILES | CC(=O)N(c1nc(C=CC(=O)Nc2ccc(C)c(Br)c2)cs1)c1ccccc1F |
| InChI | InChI=1S/C21H17BrFN3O2S/c1-13-7-8-15(11-17(13)22)24-20(28)10-9-16-12-29-21(25-16)26(14(2)27)19-6-4-3-5-18(19)23/h3-12H,1-2H3,(H,24,28) |
| InChIKey | KBXNUWAZBLRROS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|